CymitQuimica logo

CAS 1076198-33-8

:

7-Isoquinolineethanol

Description:
7-Isoquinolineethanol is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound containing a fused benzene and pyridine ring. This compound features a hydroxyl (-OH) group attached to the isoquinoline moiety, which contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the hydroxyl group can enhance its solubility in polar solvents and may influence its reactivity, making it a candidate for various chemical reactions, including alkylation and acylation. Additionally, isoquinoline derivatives are known for their biological activities, including antimicrobial and anticancer properties, which may extend to 7-Isoquinolineethanol. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be influenced by its specific molecular interactions and functional groups.
Formula:C11H11NO
InChI:InChI=1S/C11H11NO/c13-6-4-9-1-2-10-3-5-12-8-11(10)7-9/h1-3,5,7-8,13H,4,6H2
InChI key:InChIKey=CCJUXJIFTBESER-UHFFFAOYSA-N
SMILES:C(CO)C1=CC2=C(C=C1)C=CN=C2
Synonyms:
  • 7-Isoquinolineethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.