CAS 1076198-34-9
:1-Methylethyl 4-(2,1,3-benzoxadiazol-4-yl)-1,4,5,7-tetrahydro-2-methyl-5-oxofuro[3,4-b]pyridine-3-carboxylate
Description:
1-Methylethyl 4-(2,1,3-benzoxadiazol-4-yl)-1,4,5,7-tetrahydro-2-methyl-5-oxofuro[3,4-b]pyridine-3-carboxylate, with CAS number 1076198-34-9, is a complex organic compound characterized by its unique structural features, including a fused bicyclic system and a benzoxadiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of functional groups like carboxylate and oxo groups suggests it may participate in various chemical reactions, including esterification and nucleophilic attacks. Its molecular structure indicates potential interactions with biological targets, which could lead to pharmacological applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a class of compounds that may have significant implications in research and therapeutic contexts, particularly in the development of novel pharmaceuticals.
Formula:C18H17N3O5
InChI:InChI=1S/C18H17N3O5/c1-8(2)25-18(23)13-9(3)19-12-7-24-17(22)15(12)14(13)10-5-4-6-11-16(10)21-26-20-11/h4-6,8,14,19H,7H2,1-3H3
InChI key:InChIKey=MDPKWTOXKXUQSW-UHFFFAOYSA-N
SMILES:C(OC(C)C)(=O)C=1C(C2=C(NC1C)COC2=O)C=3C=4C(C=CC3)=NON4
Synonyms:- 1-Methylethyl 4-(2,1,3-benzoxadiazol-4-yl)-1,4,5,7-tetrahydro-2-methyl-5-oxofuro[3,4-b]pyridine-3-carboxylate
- Furo[3,4-b]pyridine-3-carboxylic acid, 4-(2,1,3-benzoxadiazol-4-yl)-1,4,5,7-tetrahydro-2-methyl-5-oxo-, 1-methylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
