CymitQuimica logo

CAS 1076198-41-8

:

(3-Phenyl-3-oxetanyl)methyl 2-methyl-2-propenoate

Description:
(3-Phenyl-3-oxetanyl)methyl 2-methyl-2-propenoate, identified by its CAS number 1076198-41-8, is an organic compound characterized by its unique structural features. It contains an oxetane ring, which is a four-membered cyclic ether, contributing to its reactivity and potential applications in organic synthesis. The presence of a phenyl group enhances its aromatic characteristics, potentially influencing its stability and interaction with other chemical species. The compound also features a methacrylate moiety, which is known for its ability to undergo polymerization, making it useful in the production of polymers and resins. Its chemical properties may include moderate solubility in organic solvents and potential reactivity with nucleophiles due to the presence of the ester functional group. Overall, this compound's structure suggests it may have applications in materials science, particularly in the development of specialty polymers or as an intermediate in organic synthesis. However, specific physical properties such as boiling point, melting point, and solubility would require experimental determination or detailed literature references for precise values.
Formula:C14H16O3
InChI:InChI=1S/C14H16O3/c1-11(2)13(15)17-10-14(8-16-9-14)12-6-4-3-5-7-12/h3-7H,1,8-10H2,2H3
InChI key:InChIKey=LPGBCTHZLFURRI-UHFFFAOYSA-N
SMILES:C(OC(C(C)=C)=O)C1(COC1)C2=CC=CC=C2
Synonyms:
  • (3-Phenyl-3-oxetanyl)methyl 2-methyl-2-propenoate
  • 2-Propenoic acid, 2-methyl-, (3-phenyl-3-oxetanyl)methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.