CAS 1076198-46-3
:6-[4-(4-Methoxy-2,3,6-trimethylphenyl)-1,3-butadien-1-yl]-4-methyl-2H-pyran-2-one
Description:
The chemical substance known as 6-[4-(4-Methoxy-2,3,6-trimethylphenyl)-1,3-butadien-1-yl]-4-methyl-2H-pyran-2-one, with the CAS number 1076198-46-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyranone ring and a butadiene side chain. This compound features multiple methyl groups and a methoxy substituent, contributing to its hydrophobic nature and potential biological activity. The presence of the pyranone moiety suggests that it may exhibit properties typical of flavonoids or related compounds, which are known for their antioxidant and anti-inflammatory effects. Its structural features may also indicate potential applications in pharmaceuticals or as a precursor in organic synthesis. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it important to consider these factors in practical applications. Further studies would be necessary to fully elucidate its properties and potential uses in various fields, including medicinal chemistry and materials science.
Formula:C20H22O3
InChI:InChI=1S/C20H22O3/c1-13-10-17(23-20(21)11-13)8-6-7-9-18-14(2)12-19(22-5)16(4)15(18)3/h6-12H,1-5H3
InChI key:InChIKey=COKYISJYWLHYQF-UHFFFAOYSA-N
SMILES:C(=CC=CC1=CC(C)=CC(=O)O1)C2=C(C)C(C)=C(OC)C=C2C
Synonyms:- 6-[4-(4-Methoxy-2,3,6-trimethylphenyl)-1,3-butadien-1-yl]-4-methyl-2H-pyran-2-one
- 2H-Pyran-2-one, 6-[4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-butadien-1-yl]-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.