CAS 1076198-59-8

N-[5-(5-Pyrimidinyl)-3-pyridinyl]-4-quinolinemethanamine

Description:

N-[5-(5-Pyrimidinyl)-3-pyridinyl]-4-quinolinemethanamine, with the CAS number 1076198-59-8, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and nitrogen-containing heterocycles. This compound features a quinoline core, which is known for its biological activity, particularly in medicinal chemistry. The presence of pyridine and pyrimidine rings suggests potential interactions with biological targets, making it of interest in drug development. The amine functional group indicates that it may participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature are investigated for their pharmacological properties, including anti-cancer, anti-inflammatory, or antimicrobial activities. The specific arrangement of substituents on the aromatic rings can significantly affect the compound's electronic properties and, consequently, its biological efficacy. As with many heterocyclic compounds, the synthesis and characterization of this substance would involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its structure and purity.

Formula: C₁₉H₁₅N₅

InChI: InChI=1S/C19H15N5/c1-2-4-19-18(3-1)14(5-6-23-19)11-24-17-7-15(8-20-12-17)16-9-21-13-22-10-16/h1-10,12-13,24H,11H2

InChI key: InChIKey=XJXZVPYGJYNXLR-UHFFFAOYSA-N

SMILES: C(NC=1C=C(C=NC1)C=2C=NC=NC2)C=3C4=C(N=CC3)C=CC=C4

Synonyms:

• N-[5-(5-Pyrimidinyl)-3-pyridinyl]-4-quinolinemethanamine
• 4-Quinolinemethanamine, N-[5-(5-pyrimidinyl)-3-pyridinyl]-