CAS 1076198-60-1
:2,2,2-Trifluoro-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]-N-methylacetamide
Description:
2,2,2-Trifluoro-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]-N-methylacetamide, identified by its CAS number 1076198-60-1, is a synthetic organic compound characterized by its complex molecular structure, which includes trifluoromethyl and methoxy functional groups. This compound features a trifluoroacetamide moiety, contributing to its unique chemical properties, such as increased lipophilicity and potential biological activity. The presence of the methoxy and phenylmethoxy groups suggests that it may exhibit interesting interactions with biological targets, making it of interest in pharmaceutical research. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the trifluoromethyl group can enhance metabolic stability and influence the compound's pharmacokinetic properties. As with many fluorinated compounds, it may exhibit distinct solubility and reactivity profiles compared to non-fluorinated analogs. Overall, this compound represents a class of molecules that could be valuable in drug discovery and development, although specific biological activity and safety profiles would require further investigation.
Formula:C19H20F3NO3
InChI:InChI=1S/C19H20F3NO3/c1-23(18(24)19(20,21)22)11-10-14-8-9-16(17(12-14)25-2)26-13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3
InChI key:InChIKey=GJPAPPQPMSBVAD-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(OC)C=C(CCN(C(C(F)(F)F)=O)C)C=C2
Synonyms:- 2,2,2-Trifluoro-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]-N-methylacetamide
- Acetamide, 2,2,2-trifluoro-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Methyl-N-trifluoroacetyl-4-benzyloxy-3-methoxyphenethylamine
CAS:Controlled ProductApplications N-Methyl-N-trifluoroacetyl-4-benzyloxy-3-methoxyphenethylamine (cas# 1076198-60-1) is a compound useful in organic synthesis.
Formula:C19H20F3NO3Color and Shape:NeatMolecular weight:367.36
