CymitQuimica logo

CAS 1076198-62-3

:

6-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole

Description:
The chemical substance known as 6-[[[1,1-Dimethylethyl]dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole, with the CAS number 1076198-62-3, is a complex organic compound characterized by its unique structural features. It contains a benzimidazole core, which is a bicyclic structure known for its biological activity, particularly in pharmaceuticals. The presence of a dimethylsilyl group suggests enhanced stability and potential applications in various chemical reactions or as a protective group. Additionally, the trifluoroethoxy group contributes to its lipophilicity, potentially influencing its solubility and bioavailability. The compound's thioether linkage indicates possible reactivity and interactions with biological targets. Overall, this substance may exhibit significant pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C22H28F3N3O2SSi
InChI:InChI=1S/C22H28F3N3O2SSi/c1-14-18(26-10-9-19(14)29-13-22(23,24)25)12-31-20-27-16-8-7-15(11-17(16)28-20)30-32(5,6)21(2,3)4/h7-11H,12-13H2,1-6H3,(H,27,28)
InChI key:InChIKey=XSUQJEQHDCQXRR-UHFFFAOYSA-N
SMILES:S(CC1=C(C)C(OCC(F)(F)F)=CC=N1)C=2NC=3C(N2)=CC=C(O[Si](C(C)(C)C)(C)C)C3
Synonyms:
  • 1H-Benzimidazole, 6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-
  • 6-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole
  • 2-[[[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridyl]methyl]thio]-5-(tert-butyldimethylsilyloxy)-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.