CAS 1076198-72-5

2-Pyrazinemethanol, 3-ethyl-α,5-dimethyl-, 2-acetate

Description:

2-Pyrazinemethanol, 3-ethyl-α,5-dimethyl-, 2-acetate, identified by its CAS number 1076198-72-5, is a chemical compound that belongs to the class of pyrazine derivatives. This substance typically exhibits characteristics such as a moderate molecular weight and specific functional groups that contribute to its reactivity and solubility. The presence of the pyrazine ring suggests potential biological activity, as many pyrazine derivatives are known for their pharmacological properties. The acetate group indicates that it may participate in esterification reactions, making it useful in organic synthesis. Additionally, the ethyl and dimethyl substituents can influence the compound's physical properties, such as boiling and melting points, as well as its polarity. While specific data on its toxicity and environmental impact may not be widely available, compounds of this nature should be handled with care in laboratory settings, following appropriate safety protocols. Overall, 2-Pyrazinemethanol, 3-ethyl-α,5-dimethyl-, 2-acetate represents a structurally interesting compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₁H₁₆N₂O₂

InChI: InChI=1S/C11H16N2O2/c1-5-10-11(8(3)15-9(4)14)12-6-7(2)13-10/h6,8H,5H2,1-4H3

InChI key: InChIKey=WZCFNNCLFJHBNE-UHFFFAOYSA-N

SMILES: C(OC(C)=O)(C)C=1C(CC)=NC(C)=CN1

Synonyms:

• 2-Pyrazinemethanol, 3-ethyl-α,5-dimethyl-, 2-acetate
• 2-(1-ACETOXYETHYL)-3-ETHYL-5-METHYLPYRAZINE
• 3-Ethyl-α,5-diMethyl-2-pyrazineMethanol 2-Acetate