CAS 1076198-74-7

2,5-Dioxo-1-pyrrolidinyl 1-acetyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxylate

Description:

2,5-Dioxo-1-pyrrolidinyl 1-acetyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxylate is a complex organic compound characterized by its unique structural features, including multiple functional groups such as dioxo, acetyl, and carboxylate moieties. This compound belongs to the class of pyrrole derivatives, which are known for their diverse biological activities and potential applications in pharmaceuticals and materials science. The presence of the pyrrolidinyl group suggests potential reactivity and stability under various conditions. Its molecular structure indicates a degree of steric hindrance due to the tetramethyl substituents, which may influence its solubility and interaction with biological targets. The compound's CAS number, 1076198-74-7, allows for precise identification and retrieval of information in chemical databases. Overall, this substance may exhibit interesting chemical properties and biological activities, making it a subject of interest for further research and development in synthetic chemistry and medicinal applications.

Formula: C₁₅H₂₀N₂O₅

InChI: InChI=1S/C15H20N2O5/c1-9(18)17-14(2,3)8-10(15(17,4)5)13(21)22-16-11(19)6-7-12(16)20/h8H,6-7H2,1-5H3

InChI key: InChIKey=NWRHMOJKYFPIQY-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C(C)(C)C(C(ON2C(=O)CCC2=O)=O)=CC1(C)C

Synonyms:

• 2,5-Dioxo-1-pyrrolidinyl 1-acetyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxylate
• 1H-Pyrrole-3-carboxylic acid, 1-acetyl-2,5-dihydro-2,2,5,5-tetramethyl-, 2,5-dioxo-1-pyrrolidinyl ester

1-Acetyl-2,2,5,5-tetramethyl-3-pyrroline-3-carboxylic Acid N-Hydroxysuccinimide Ester

Controlled Product

CAS: 1076198-74-7

Applications 1-Acetyl-2,2,5,5-tetramethyl-3-pyrroline-3-carboxylic Acid N-Hydroxysuccinimide Ester (cas# 1076198-74-7) is a compound useful in organic synthesis.

Formula: C₁₅H₂₀N₂O₅

Color and Shape: Neat

Molecular weight: 308.33

Ref: TR-A188535