CAS 1076198-75-8

N-[3-(Acetylthio)-2-methyl-1-oxopropyl]glycine 1,1-dimethylethyl ester

Description:

N-[3-(Acetylthio)-2-methyl-1-oxopropyl]glycine 1,1-dimethylethyl ester, identified by its CAS number 1076198-75-8, is a chemical compound that features a glycine derivative with an acetylthio group and an ester functional group. This compound is characterized by its complex structure, which includes a propyl chain with a ketone and a thioether moiety, contributing to its potential reactivity and biological activity. The presence of the dimethylethyl ester group suggests that it may exhibit lipophilic properties, enhancing its solubility in organic solvents. Such characteristics may influence its pharmacokinetics and bioavailability if considered for pharmaceutical applications. Additionally, the acetylthio group may impart specific chemical reactivity, making it a candidate for further chemical transformations or as a building block in synthetic organic chemistry. Overall, this compound's unique structural features position it as an interesting subject for research in medicinal chemistry and related fields.

Formula: C₁₂H₂₁NO₄S

InChI: InChI=1S/C12H21NO4S/c1-8(7-18-9(2)14)11(16)13-6-10(15)17-12(3,4)5/h8H,6-7H2,1-5H3,(H,13,16)

InChI key: InChIKey=OYYYGUPYKZEDQD-UHFFFAOYSA-N

SMILES: C(CNC(C(CSC(C)=O)C)=O)(OC(C)(C)C)=O

Synonyms:

• N-[3-(Acetylthio)-2-methyl-1-oxopropyl]glycine 1,1-dimethylethyl ester
• Glycine, N-[3-(acetylthio)-2-methyl-1-oxopropyl]-, 1,1-dimethylethyl ester

N-(3-Acetylthio-2-methylpropanoyl)glycine tert-butyl ester

CAS: 1076198-75-8

Molecular weight: 275.36

Ref: 7W-GM1685