CAS 1076198-84-9
:N7-Methyl-7,8-quinolinediamine
Description:
N7-Methyl-7,8-quinolinediamine, identified by its CAS number 1076198-84-9, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of two amino groups and a methyl group at specific positions on the quinoline structure contributes to its unique chemical properties. Typically, compounds of this nature exhibit interesting biological activities, which may include antimicrobial or antitumor properties, making them of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on the functional groups attached to the quinoline structure. Additionally, its synthesis and characterization often involve standard organic chemistry techniques, including chromatography and spectroscopy. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the biological effects and environmental impact of such compounds can be significant.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c1-12-8-5-4-7-3-2-6-13-10(7)9(8)11/h2-6,12H,11H2,1H3
InChI key:InChIKey=MLYXWCHYCCMJRC-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC1NC)C=CC=N2
Synonyms:- N7-Methyl-7,8-quinolinediamine
- 7,8-Quinolinediamine, N7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.