CymitQuimica logo

CAS 1076198-90-7

:

2,3-Dihydro-5-methoxy-6-(phenylmethoxy)-2-[[1-(phenylmethyl)-4-piperidinyl]methylene]-1H-inden-1-one

Description:
2,3-Dihydro-5-methoxy-6-(phenylmethoxy)-2-[[1-(phenylmethyl)-4-piperidinyl]methylene]-1H-inden-1-one, with CAS number 1076198-90-7, is a synthetic organic compound characterized by its complex molecular structure, which includes an indene core, methoxy groups, and a piperidine moiety. This compound typically exhibits properties associated with its functional groups, such as potential lipophilicity due to the presence of aromatic rings and methoxy substituents. It may demonstrate biological activity, possibly interacting with various receptors or enzymes, making it of interest in medicinal chemistry. The presence of the piperidine ring suggests potential pharmacological properties, as piperidine derivatives are often explored for their effects on the central nervous system. Additionally, the compound's stability, solubility, and reactivity would depend on its specific molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that could have applications in drug development or as research tools in biochemistry.
Formula:C30H31NO3
InChI:InChI=1S/C30H31NO3/c1-33-28-18-25-17-26(16-22-12-14-31(15-13-22)20-23-8-4-2-5-9-23)30(32)27(25)19-29(28)34-21-24-10-6-3-7-11-24/h2-11,16,18-19,22H,12-15,17,20-21H2,1H3
InChI key:InChIKey=WFVLOAOZVBVDEA-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC1=CC3CCN(CC4=CC=CC=C4)CC3)=CC(OC)=C(OCC5=CC=CC=C5)C2
Synonyms:
  • 1H-Inden-1-one, 2,3-dihydro-5-methoxy-6-(phenylmethoxy)-2-[[1-(phenylmethyl)-4-piperidinyl]methylene]-
  • 2,3-Dihydro-5-methoxy-6-(phenylmethoxy)-2-[[1-(phenylmethyl)-4-piperidinyl]methylene]-1H-inden-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.