CAS 1076198-95-2
:N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-N-methyl-5-(phenylmethoxy)-2-pyridinamine
Description:
N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-N-methyl-5-(phenylmethoxy)-2-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring, a siloxy group, and a phenylmethoxy moiety. The presence of the dimethylsilyl group suggests that it may exhibit unique properties such as increased hydrophobicity and stability, which can enhance its solubility in organic solvents. The compound features both amine and ether functional groups, indicating potential reactivity and interactions with various chemical species. Its molecular architecture may allow for specific binding interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the bulky tert-butyl group may influence its steric properties, potentially affecting its biological activity and pharmacokinetics. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C21H32N2O2Si
InChI:InChI=1S/C21H32N2O2Si/c1-21(2,3)26(5,6)25-15-14-23(4)20-13-12-19(16-22-20)24-17-18-10-8-7-9-11-18/h7-13,16H,14-15,17H2,1-6H3
InChI key:InChIKey=OUIKDKSONMPOEJ-UHFFFAOYSA-N
SMILES:N(CCO[Si](C(C)(C)C)(C)C)(C)C1=CC=C(OCC2=CC=CC=C2)C=N1
Synonyms:- N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-N-methyl-5-(phenylmethoxy)-2-pyridinamine
- 2-Pyridinamine, N-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-N-methyl-5-(phenylmethoxy)-
- 3-Benzyloxy{6-[2-(tert-Butyldimethylsilyloxy)ethyl]methylamino}pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Benzyloxy[6-[2-(tert-Butyldimethylsilyloxy)ethyl]methylamino]pyridine
CAS:Controlled ProductApplications 3-Benzyloxy[6-[2-(tert-Butyldimethylsilyloxy)ethyl]methylamino]pyridine (cas# 1076198-95-2) is a compound useful in organic synthesis.
Formula:C21H32N2O2SiColor and Shape:NeatMolecular weight:372.58
