CymitQuimica logo

CAS 1076198-99-6

:

1,3-Diethyl 2-(formylamino)-2-[[7-(phenylmethoxy)-1H-indol-3-yl]methyl]propanedioate

Description:
1,3-Diethyl 2-(formylamino)-2-[[7-(phenylmethoxy)-1H-indol-3-yl]methyl]propanedioate, with CAS number 1076198-99-6, is a complex organic compound characterized by its multi-functional groups, including diethyl ester, formylamino, and an indole moiety. This compound features a propanedioate backbone, which contributes to its potential reactivity and solubility properties. The presence of the formylamino group suggests it may participate in various chemical reactions, such as condensation or nucleophilic addition. The indole structure, known for its aromaticity and biological significance, may impart unique pharmacological properties, making this compound of interest in medicinal chemistry. Additionally, the phenylmethoxy substituent enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. Overall, this compound's intricate structure and functional groups suggest a diverse range of applications, particularly in drug development and organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C24H26N2O6
InChI:InChI=1S/C24H26N2O6/c1-3-30-22(28)24(26-16-27,23(29)31-4-2)13-18-14-25-21-19(18)11-8-12-20(21)32-15-17-9-6-5-7-10-17/h5-12,14,16,25H,3-4,13,15H2,1-2H3,(H,26,27)
InChI key:InChIKey=ABDOJCPPJSPZBO-UHFFFAOYSA-N
SMILES:C(CC=1C=2C(NC1)=C(OCC3=CC=CC=C3)C=CC2)(C(OCC)=O)(C(OCC)=O)NC=O
Synonyms:
  • 1,3-Diethyl 2-(formylamino)-2-[[7-(phenylmethoxy)-1H-indol-3-yl]methyl]propanedioate
  • Propanedioic acid, 2-(formylamino)-2-[[7-(phenylmethoxy)-1H-indol-3-yl]methyl]-, 1,3-diethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.