CymitQuimica logo

CAS 1076199-04-6

:

3-[2-[Methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]benzaldehyde

Description:
3-[2-[Methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]benzaldehyde is a complex organic compound characterized by its unique molecular structure, which includes a benzaldehyde functional group, an ethoxy linkage, and a pyridine ring substituted with a phenylmethoxy group. This compound is likely to exhibit properties typical of aromatic aldehydes, such as reactivity in nucleophilic addition reactions and potential for undergoing oxidation. The presence of the pyridine moiety suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the methyl and phenylmethoxy substituents may influence its solubility, stability, and overall reactivity. The compound's specific characteristics, including melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. As with many organic compounds, its behavior in various chemical reactions can be influenced by factors such as pH, temperature, and the presence of catalysts or solvents.
Formula:C22H22N2O3
InChI:InChI=1S/C22H22N2O3/c1-24(12-13-26-20-9-5-8-19(14-20)16-25)22-11-10-21(15-23-22)27-17-18-6-3-2-4-7-18/h2-11,14-16H,12-13,17H2,1H3
InChI key:InChIKey=TWEVEMPYGBAZTL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=CC(N(CCOC3=CC(C=O)=CC=C3)C)=NC2
Synonyms:
  • Benzaldehyde, 3-[2-[methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]-
  • 3-[2-[Methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.