CAS 1076199-05-7
:5-[[3-[2-[Methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]phenyl]methylene]-2,4-thiazolidinedione
Description:
The chemical substance known as 5-[[3-[2-[Methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]phenyl]methylene]-2,4-thiazolidinedione, with the CAS number 1076199-05-7, is a thiazolidinedione derivative, which is a class of compounds known for their potential therapeutic applications, particularly in the treatment of diabetes and metabolic disorders. This compound features a thiazolidinedione core, characterized by a five-membered ring containing sulfur and nitrogen, which is linked to various aromatic and aliphatic substituents. The presence of a pyridine ring and a phenylmethoxy group suggests that it may exhibit significant biological activity, potentially influencing pathways related to insulin sensitivity and glucose metabolism. The structural complexity, including multiple functional groups, indicates that it may interact with various biological targets, making it a candidate for further pharmacological studies. As with many synthetic compounds, its solubility, stability, and reactivity would depend on the specific conditions under which it is studied.
Formula:C25H23N3O4S
InChI:InChI=1S/C25H23N3O4S/c1-28(23-11-10-21(16-26-23)32-17-18-6-3-2-4-7-18)12-13-31-20-9-5-8-19(14-20)15-22-24(29)27-25(30)33-22/h2-11,14-16H,12-13,17H2,1H3,(H,27,29,30)
InChI key:InChIKey=QQHXAPZOYSKUDZ-UHFFFAOYSA-N
SMILES:C(C1=CC(OCCN(C)C2=CC=C(OCC3=CC=CC=C3)C=N2)=CC=C1)=C4C(=O)NC(=O)S4
Synonyms:- 2,4-Thiazolidinedione, 5-[[3-[2-[methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]phenyl]methylene]-
- 5-[[3-[2-[Methyl[5-(phenylmethoxy)-2-pyridinyl]amino]ethoxy]phenyl]methylene]-2,4-thiazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-{4-[2-[(5-Benzyloxypyridin-2-yl)methylamino]ethoxy]benzylidine}thiazolidine-2,4-dione
CAS:Controlled Product<p>Applications 5-{4-[2-[(5-Benzyloxypyridin-2-yl)methylamino]ethoxy]benzylidine}thiazolidine-2,4-dione (cas# 1076199-05-7) is a compound useful in organic synthesis.<br></p>Formula:C25H23N3O4SColor and Shape:NeatMolecular weight:461.53
