CAS 1076199-13-7
:3-[3,4-Bis(ethoxymethoxy)phenyl]-1-[2,4,6-tris(ethoxymethoxy)phenyl]-2-propen-1-one
Description:
The chemical substance known as "3-[3,4-Bis(ethoxymethoxy)phenyl]-1-[2,4,6-tris(ethoxymethoxy)phenyl]-2-propen-1-one," with the CAS number 1076199-13-7, is a complex organic compound characterized by its structure, which includes multiple ethoxymethoxy groups attached to phenyl rings. This compound typically exhibits properties associated with conjugated systems, such as potential chromophoric behavior, which may impart color and light absorption characteristics. The presence of multiple ethoxymethoxy substituents suggests enhanced solubility in organic solvents and may influence its reactivity and stability. Additionally, the compound may possess interesting electronic properties due to the delocalization of π-electrons across the conjugated framework, making it a candidate for applications in organic electronics or as a dye. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in various chemical environments could be explored for potential applications in materials science or medicinal chemistry. However, specific biological activity or toxicity data would require further investigation.
Formula:C30H42O11
InChI:InChI=1S/C30H42O11/c1-6-32-18-37-24-16-28(40-21-35-9-4)30(29(17-24)41-22-36-10-5)25(31)13-11-23-12-14-26(38-19-33-7-2)27(15-23)39-20-34-8-3/h11-17H,6-10,18-22H2,1-5H3
InChI key:InChIKey=FXOPQTDPXICDBZ-UHFFFAOYSA-N
SMILES:O(COCC)C1=C(C(C=CC2=CC(OCOCC)=C(OCOCC)C=C2)=O)C(OCOCC)=CC(OCOCC)=C1
Synonyms:- 2-Propen-1-one, 3-[3,4-bis(ethoxymethoxy)phenyl]-1-[2,4,6-tris(ethoxymethoxy)phenyl]-
- 3-[3,4-Bis(ethoxymethoxy)phenyl]-1-[2,4,6-tris(ethoxymethoxy)phenyl]-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.