CAS 1076199-18-2
:1,1-Dimethylethyl N-[2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]carbamate
Description:
1,1-Dimethylethyl N-[2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]carbamate, identified by its CAS number 1076199-18-2, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a tert-butyl group, a hydroxycyclohexyl moiety, and a methoxyphenyl group, which contribute to its unique chemical properties. The presence of the carbamate functional group indicates potential applications in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit specific biological activities, influenced by its structural components, such as potential interactions with biological receptors or enzymes. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many organic compounds, safety and handling precautions are essential, as they may pose risks if not managed properly. Further studies would be necessary to fully elucidate its properties, potential applications, and safety profile.
Formula:C20H31NO4
InChI:InChI=1S/C20H31NO4/c1-19(2,3)25-18(22)21-14-17(20(23)12-6-5-7-13-20)15-8-10-16(24-4)11-9-15/h8-11,17,23H,5-7,12-14H2,1-4H3,(H,21,22)
InChI key:InChIKey=LYYFWPXFGIXLSQ-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)(C1=CC=C(OC)C=C1)C2(O)CCCCC2
Synonyms:- Carbamic acid, N-[2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.