CymitQuimica logo

CAS 1076199-19-3

:

7-Ethyl 1-methyl 2-[2-[[(1,1-dimethylethoxy)carbonyl]amino]-1-oxopropyl]heptanedioate

Description:
7-Ethyl 1-methyl 2-[2-[[(1,1-dimethylethoxy)carbonyl]amino]-1-oxopropyl]heptanedioate, with the CAS number 1076199-19-3, is a complex organic compound characterized by its multi-functional groups and structural features. This substance contains a heptanedioate backbone, indicating the presence of two carboxylic acid functional groups, which contribute to its potential acidity and reactivity. The presence of an ethyl and a methyl group suggests that it may exhibit hydrophobic characteristics, while the dimethylethoxycarbonyl group introduces steric hindrance and may influence its solubility and reactivity in various solvents. The amino and carbonyl functionalities indicate that it may participate in various chemical reactions, such as amide bond formation or nucleophilic attacks. Overall, this compound's unique structure may render it useful in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules or as a building block in pharmaceutical applications. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C18H31NO7
InChI:InChI=1S/C18H31NO7/c1-7-25-14(20)11-9-8-10-13(16(22)24-6)15(21)12(2)19-17(23)26-18(3,4)5/h12-13H,7-11H2,1-6H3,(H,19,23)
InChI key:InChIKey=QJOWBWKFPGEJSO-UHFFFAOYSA-N
SMILES:C(C(C(NC(OC(C)(C)C)=O)C)=O)(CCCCC(OCC)=O)C(OC)=O
Synonyms:
  • Heptanedioic acid, 2-[2-[[(1,1-dimethylethoxy)carbonyl]amino]-1-oxopropyl]-, 7-ethyl 1-methyl ester
  • 7-Ethyl 1-methyl 2-[2-[[(1,1-dimethylethoxy)carbonyl]amino]-1-oxopropyl]heptanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.