CAS 1076199-24-0
:1,1-Dimethylethyl N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]carbamate
Description:
1,1-Dimethylethyl N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]carbamate, identified by its CAS number 1076199-24-0, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a tert-butyl group, a cyclohexyl moiety, and a phenolic component, which contribute to its unique chemical properties. It is typically synthesized through organic reactions involving carbamate formation and may exhibit biological activity, potentially serving as a pharmaceutical or agrochemical agent. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its functional groups suggest potential interactions with biological systems, making it of interest for research in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.
Formula:C19H29NO4
InChI:InChI=1S/C19H29NO4/c1-18(2,3)24-17(22)20-13-16(14-7-9-15(21)10-8-14)19(23)11-5-4-6-12-19/h7-10,16,21,23H,4-6,11-13H2,1-3H3,(H,20,22)
InChI key:InChIKey=AGTIUSJAKDOMBF-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)(C1=CC=C(O)C=C1)C2(O)CCCCC2
Synonyms:- Carbamic acid, N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)ethyl]carbamate
- N-Boc N,O-Didesmethylvenlafaxine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Boc N,O-Didesmethylvenlafaxine
CAS:Controlled ProductApplications A derivative of Venlafaxine.
Formula:C20H31NO4Color and Shape:NeatMolecular weight:349.46
