CAS 1076199-27-3
:5-(1-Nitroso-2-pyrrolidinyl)-3-pyridinecarboxylic acid
Description:
5-(1-Nitroso-2-pyrrolidinyl)-3-pyridinecarboxylic acid, identified by its CAS number 1076199-27-3, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a nitroso-pyrrolidine moiety. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the nitroso group, known for its reactivity and ability to form nitrosamines. The pyridine and pyrrolidine rings contribute to its structural complexity and may influence its solubility and reactivity in different solvents. The carboxylic acid functional group suggests that the compound can participate in acid-base reactions and may exhibit polar characteristics, affecting its behavior in biological systems. Overall, this compound's unique structure may make it of interest in medicinal chemistry and pharmacology, although specific applications and effects would require further investigation.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c14-10(15)8-4-7(5-11-6-8)9-2-1-3-13(9)12-16/h4-6,9H,1-3H2,(H,14,15)
InChI key:InChIKey=LHWMJVSDDYACRF-UHFFFAOYSA-N
SMILES:N(=O)N1C(C=2C=C(C(O)=O)C=NC2)CCC1
Synonyms:- 3-Pyridinecarboxylic acid, 5-(1-nitroso-2-pyrrolidinyl)-
- 5-(1-Nitroso-2-pyrrolidinyl)-3-pyridinecarboxylic acid
- N’-Nitrosonornicotine-5-carboxylic Acid
- LHWMJVSDDYACRF-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N’-Nitrosonornicotine-5-carboxylic Acid
CAS:Controlled ProductFormula:C10H11N3O3Color and Shape:NeatMolecular weight:221.213
