CAS 1076199-32-0
:3-Methoxy-N-(3-phenyl-2-propen-1-yl)benzenamine
Description:
3-Methoxy-N-(3-phenyl-2-propen-1-yl)benzenamine, identified by its CAS number 1076199-32-0, is an organic compound characterized by its aromatic amine structure. It features a methoxy group (-OCH3) and a propenyl side chain attached to a phenyl group, contributing to its potential reactivity and biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility in organic solvents and its interaction with biological membranes. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anticancer properties, due to the presence of the phenyl and propenyl moieties that are often associated with bioactive compounds. Additionally, the amine functional group can participate in various chemical reactions, including alkylation and acylation, making it a versatile intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C16H17NO
InChI:InChI=1S/C16H17NO/c1-18-16-11-5-10-15(13-16)17-12-6-9-14-7-3-2-4-8-14/h2-11,13,17H,12H2,1H3
InChI key:InChIKey=LWLWLTGJUXMEHE-UHFFFAOYSA-N
SMILES:N(CC=CC1=CC=CC=C1)C2=CC(OC)=CC=C2
Synonyms:- Benzenamine, 3-methoxy-N-(3-phenyl-2-propen-1-yl)-
- 3-Methoxy-N-(3-phenyl-2-propen-1-yl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.