CAS 1076199-36-4

N-Ethynyl-N,α-dimethyl-3-pyridineethanamine

Description:

N-Ethynyl-N,α-dimethyl-3-pyridineethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and an ethynyl group. This compound features a dimethyl substitution at the nitrogen atom, contributing to its basicity and potential reactivity. The presence of the ethynyl group suggests that it may participate in various chemical reactions, including those typical of alkynes, such as nucleophilic additions or cycloadditions. The pyridine moiety can influence the compound's solubility and interaction with biological systems, potentially making it of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many nitrogen-containing compounds, it may exhibit basic behavior, allowing it to form salts with acids. Overall, N-Ethynyl-N,α-dimethyl-3-pyridineethanamine represents a versatile structure that could be explored for various applications in organic synthesis and pharmacology.

Formula: C₁₁H₁₄N₂

InChI: InChI=1S/C11H14N2/c1-4-13(3)10(2)8-11-6-5-7-12-9-11/h1,5-7,9-10H,8H2,2-3H3

InChI key: InChIKey=KDNROKOBMXMJEY-UHFFFAOYSA-N

SMILES: C(C(N(C#C)C)C)C=1C=CC=NC1

Synonyms:

• N-Ethynyl-N,α-dimethyl-3-pyridineethanamine
• 3-Pyridineethanamine, N-ethynyl-N,α-dimethyl-