CAS 1076199-42-2

P,P,P′,P′-Tetramethyl P,P′-[1-hydroxy-3-(methylpentylamino)propylidene]bis[phosphonate]

Description:

P,P,P′,P′-Tetramethyl P,P′-[1-hydroxy-3-(methylpentylamino)propylidene]bis[phosphonate] is a chemical compound characterized by its phosphonate functional groups, which are known for their applications in various fields, including agriculture and pharmaceuticals. This substance features a complex structure that includes a hydroxy group and an amino group, contributing to its potential reactivity and biological activity. The presence of multiple methyl groups suggests that it may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, the phosphonate moieties can participate in various chemical reactions, making it a candidate for further research in medicinal chemistry or as a potential agrochemical. Its specific properties, such as stability, reactivity, and toxicity, would depend on the conditions under which it is used, and further studies would be necessary to fully understand its behavior in different environments. Overall, this compound represents a unique class of organophosphorus compounds with potential applications in diverse scientific fields.

Formula: C₁₃H₃₁NO₇P₂

InChI: InChI=1S/C13H31NO7P2/c1-7-8-9-11-14(2)12-10-13(15,22(16,18-3)19-4)23(17,20-5)21-6/h15H,7-12H2,1-6H3

InChI key: InChIKey=KPSNZWOXCPASBB-UHFFFAOYSA-N

SMILES: C(P(OC)(OC)=O)(P(OC)(OC)=O)(CCN(CCCCC)C)O

Synonyms:

• Phosphonic acid, P,P′-[1-hydroxy-3-(methylpentylamino)propylidene]bis-, P,P,P′,P′-tetramethyl ester
• P,P,P′,P′-Tetramethyl P,P′-[1-hydroxy-3-(methylpentylamino)propylidene]bis[phosphonate]
• Ibandronate Tetramethyl Ester
• Tetramethyl Ibandronate
• Ibandronate Impurity 22
• P,P'-[1-Hydroxy-3-(MethylpentylaMino)propylidene]bisphosphonic Acid P,P,P',P'-TetraMethyl Ester
• 1,1-bis(dimethoxyphosphoryl)-3-[methyl(pentyl)amino]propan-1-ol

Tetramethyl Ibandronate

Controlled Product

CAS: 1076199-42-2

Formula: C₁₃H₃₁NO₇P₂

Color and Shape: Neat

Molecular weight: 375.34

Ref: TR-T303300

Tetramethyl Ibandronate

CAS: 1076199-42-2

Formula: C₁₃H₃₁NO₇P₂

Molecular weight: 375.34

Ref: ST-EA-CP-I105002