CAS 1076199-47-7
:N-[3-[5-Cyano-1-(4-fluorophenyl)-1,3-dihydro-1-isobenzofuranyl]propyl]-2,2,2-trifluoroacetamide
Description:
N-[3-[5-Cyano-1-(4-fluorophenyl)-1,3-dihydro-1-isobenzofuranyl]propyl]-2,2,2-trifluoroacetamide is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. The presence of a cyano group indicates potential reactivity and polarity, while the trifluoroacetamide moiety contributes to its lipophilicity and potential biological activity. The compound features a fluorinated aromatic ring, which often enhances the compound's stability and alters its electronic properties, making it of interest in medicinal chemistry. Its isobenzofuran structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. The compound's unique arrangement of atoms and functional groups may also influence its solubility, melting point, and reactivity, which are critical for its application in various chemical and biological contexts. Overall, this compound exemplifies the intricate design often found in drug development, where specific modifications can lead to desired therapeutic effects.
Formula:C20H16F4N2O2
InChI:InChI=1S/C20H16F4N2O2/c21-16-5-3-15(4-6-16)19(8-1-9-26-18(27)20(22,23)24)17-7-2-13(11-25)10-14(17)12-28-19/h2-7,10H,1,8-9,12H2,(H,26,27)
InChI key:InChIKey=WAXPNSRROUWKMK-UHFFFAOYSA-N
SMILES:C(CCNC(C(F)(F)F)=O)C1(C=2C(CO1)=CC(C#N)=CC2)C3=CC=C(F)C=C3
Synonyms:- Acetamide, N-[3-[5-cyano-1-(4-fluorophenyl)-1,3-dihydro-1-isobenzofuranyl]propyl]-2,2,2-trifluoro-
- N-[3-[5-Cyano-1-(4-fluorophenyl)-1,3-dihydro-1-isobenzofuranyl]propyl]-2,2,2-trifluoroacetamide
- N-TRIFLUOROACETODIDEMETHYLCITALOPRAM
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
