CAS 1076199-59-1

7-(3-Bromopropoxy)-2(1H)-quinolinone

Description:

7-(3-Bromopropoxy)-2(1H)-quinolinone is a chemical compound characterized by its quinolinone core structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. The presence of a bromopropoxy substituent at the 7-position introduces both a bromine atom and a propoxy group, which can influence the compound's solubility, reactivity, and biological activity. This compound may exhibit interesting pharmacological properties due to the quinolinone moiety, which is often associated with various biological activities, including antimicrobial and anticancer effects. The bromine atom can enhance the lipophilicity of the molecule, potentially affecting its interaction with biological targets. Additionally, the propoxy group may contribute to the overall stability and solubility of the compound in organic solvents. As with many synthetic organic compounds, the specific characteristics, such as melting point, boiling point, and spectral data, would need to be determined experimentally or sourced from chemical databases for precise applications in research or industry.

Formula: C₁₂H₁₂BrNO₂

InChI: InChI=1S/C12H12BrNO2/c13-6-1-7-16-10-4-2-9-3-5-12(15)14-11(9)8-10/h2-5,8H,1,6-7H2,(H,14,15)

InChI key: InChIKey=RHJNUFWFQIAFTD-UHFFFAOYSA-N

SMILES: O(CCCBr)C=1C=C2C(=CC1)C=CC(=O)N2

Synonyms:

• 7-(3-Bromopropoxy)-2(1H)-quinolinone
• 2(1H)-Quinolinone, 7-(3-bromopropoxy)-
• 7-(3-Bromopropoxy)quinolin-2(1H)-one