CymitQuimica logo

CAS 1076199-63-7

:

6-[4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1,3-dihydro-6-methoxy-7-methyl-3-oxo-5-isobenzofuranyl]-4-methyl-4-hexenoic acid

Description:
The chemical substance known as 6-[4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1,3-dihydro-6-methoxy-7-methyl-3-oxo-5-isobenzofuranyl]-4-methyl-4-hexenoic acid, with the CAS number 1076199-63-7, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a hexenoic acid moiety, which suggests potential reactivity typical of unsaturated carboxylic acids. The presence of a dimethylsilyl group indicates that the compound may exhibit enhanced stability and solubility in organic solvents, while the methoxy and isobenzofuran components contribute to its potential biological activity and interaction with various biological systems. This compound may be of interest in fields such as medicinal chemistry or materials science due to its intricate structure and potential applications. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, its complexity suggests a multifaceted role in chemical reactions or as a precursor in synthetic pathways.
Formula:C23H34O6Si
InChI:InChI=1S/C23H34O6Si/c1-14(10-12-18(24)25)9-11-16-20(27-6)15(2)17-13-28-22(26)19(17)21(16)29-30(7,8)23(3,4)5/h9H,10-13H2,1-8H3,(H,24,25)
InChI key:InChIKey=ZMTFSZLFEGAGIR-UHFFFAOYSA-N
SMILES:O([Si](C(C)(C)C)(C)C)C1=C2C(=C(C)C(OC)=C1CC=C(CCC(O)=O)C)COC2=O
Synonyms:
  • 4-Hexenoic acid, 6-[4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1,3-dihydro-6-methoxy-7-methyl-3-oxo-5-isobenzofuranyl]-4-methyl-
  • 6-[4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1,3-dihydro-6-methoxy-7-methyl-3-oxo-5-isobenzofuranyl]-4-methyl-4-hexenoic acid
  • 4'-TERT-BUTYLDIMETHYLSILYLMYCOPHENOLIC ACID
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.