CAS 1076199-66-0

3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-5-(methylamino)-5-oxopentanoic acid

Description:

3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-5-(methylamino)-5-oxopentanoic acid, with the CAS number 1076199-66-0, is a chemical compound characterized by its complex structure that includes a silyl ether group, an amino group, and a carboxylic acid functionality. This compound typically exhibits properties associated with both organic and organosilicon chemistry, including potential hydrophobic characteristics due to the presence of the tert-butyl and dimethylsilyl groups. The amino and carboxylic acid groups suggest that it may participate in hydrogen bonding, influencing its solubility and reactivity in various solvents. Additionally, the oxo group contributes to its potential reactivity in condensation reactions or as a precursor in synthetic pathways. The presence of multiple functional groups indicates that this compound could be of interest in medicinal chemistry or materials science, where its unique properties might be exploited for specific applications. Overall, its structural features suggest a versatile compound with potential utility in various chemical contexts.

Formula: C₁₂H₂₅NO₄Si

InChI: InChI=1S/C12H25NO4Si/c1-12(2,3)18(5,6)17-9(8-11(15)16)7-10(14)13-4/h9H,7-8H2,1-6H3,(H,13,14)(H,15,16)

InChI key: InChIKey=PIWZJBMLFTWCNM-UHFFFAOYSA-N

SMILES: C(O[Si](C(C)(C)C)(C)C)(CC(NC)=O)CC(O)=O

Synonyms:

• Pentanoic acid, 3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-5-(methylamino)-5-oxo-
• 3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-5-(methylamino)-5-oxopentanoic acid
• 3-(tert-Butyldimethylsilyloxy)-5-(1-methylamino)-5-oxopentanoic Acid
• 3-[(1,1-Dimethylethyl)dimethylsilyloxy]-5-(1-methylamino)-5-oxopentanoic Acid