CAS 1076199-73-9

S-[2-[(1,2-Dihydro-4-methyl-2-oxo-7-quinolinyl)amino]-2-oxoethyl] methanesulfonothioate

Description:

S-[2-[(1,2-Dihydro-4-methyl-2-oxo-7-quinolinyl)amino]-2-oxoethyl] methanesulfonothioate, with the CAS number 1076199-73-9, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a methanesulfonothioate group. This compound is likely to exhibit properties typical of sulfonothioates, such as potential reactivity due to the presence of the sulfonyl and thioester functionalities. The quinoline ring contributes to its biological activity, possibly influencing its interaction with biological targets. The presence of the amino and keto groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, which could affect its solubility and stability. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the quinoline structure, which is known for various biological activities. Overall, this compound's unique structural features may confer specific chemical reactivity and biological properties, making it of interest in research and development contexts.

Formula: C₁₃H₁₄N₂O₄S₂

InChI: InChI=1S/C13H14N2O4S2/c1-8-5-12(16)15-11-6-9(3-4-10(8)11)14-13(17)7-20-21(2,18)19/h3-6H,7H2,1-2H3,(H,14,17)(H,15,16)

InChI key: InChIKey=OZYQGMKTSNMWBF-UHFFFAOYSA-N

SMILES: CC=1C=2C(=CC(NC(CSS(C)(=O)=O)=O)=CC2)NC(=O)C1

Synonyms:

• Methanesulfonothioic acid, S-[2-[(1,2-dihydro-4-methyl-2-oxo-7-quinolinyl)amino]-2-oxoethyl] ester
• S-[2-[(1,2-Dihydro-4-methyl-2-oxo-7-quinolinyl)amino]-2-oxoethyl] methanesulfonothioate

Carbostyril 124 N-Carboxymethyl Methanethiosulfonate

Controlled Product

CAS: 1076199-73-9

Applications UV-dyes.

Formula: C₁₃H₁₄N₂O₄S₂

Color and Shape: Neat

Molecular weight: 326.39

Ref: TR-C177663