CAS 1076199-75-1
:1-(1,2-Dihydro-4-methyl-2-oxo-7-quinolinyl)-1H-pyrrole-2,5-dione
Description:
1-(1,2-Dihydro-4-methyl-2-oxo-7-quinolinyl)-1H-pyrrole-2,5-dione, identified by its CAS number 1076199-75-1, is a synthetic organic compound that features a complex structure combining elements of quinoline and pyrrole. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique molecular configuration. The presence of the quinoline moiety suggests possible applications in medicinal chemistry, as quinolines are known for their diverse pharmacological properties. The pyrrole-2,5-dione part of the molecule may contribute to its reactivity and stability, influencing its interactions in biological systems. Additionally, the methyl and keto groups in the structure can affect solubility and lipophilicity, which are critical for drug development. Overall, this compound's characteristics make it a subject of interest for research in fields such as drug discovery and materials science, although specific biological activities and applications would require further investigation.
Formula:C14H10N2O3
InChI:InChI=1S/C14H10N2O3/c1-8-6-12(17)15-11-7-9(2-3-10(8)11)16-13(18)4-5-14(16)19/h2-7H,1H3,(H,15,17)
InChI key:InChIKey=XHTNRWCYHKFZOL-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC(=CC2)N3C(=O)C=CC3=O)NC(=O)C1
Synonyms:- 1H-Pyrrole-2,5-dione, 1-(1,2-dihydro-4-methyl-2-oxo-7-quinolinyl)-
- 1-(1,2-Dihydro-4-methyl-2-oxo-7-quinolinyl)-1H-pyrrole-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.