CymitQuimica logo

CAS 1076199-77-3

:

3-[3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid

Description:
3-[3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid, identified by its CAS number 1076199-77-3, is a chemical compound characterized by its complex structure, which includes a hydroxybenzoic acid moiety and a bis(1-methylethyl)amino group. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of polar hydroxyl and carboxylic acid functional groups, alongside the hydrophobic alkyl amine substituents. It may display biological activity, potentially acting as a pharmaceutical agent or a biochemical probe, depending on its specific interactions within biological systems. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm its purity and structural integrity. Overall, this compound's unique features make it of interest in medicinal chemistry and related fields.
Formula:C22H29NO3
InChI:InChI=1S/C22H29NO3/c1-15(2)23(16(3)4)13-12-19(17-8-6-5-7-9-17)20-14-18(22(25)26)10-11-21(20)24/h5-11,14-16,19,24H,12-13H2,1-4H3,(H,25,26)
InChI key:InChIKey=NKTNTJFTBRPQIZ-UHFFFAOYSA-N
SMILES:C(CCN(C(C)C)C(C)C)(C1=CC(C(O)=O)=CC=C1O)C2=CC=CC=C2
Synonyms:
  • Benzoic acid, 3-[3-[bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxy-
  • 3-(3-Diisopropylamino-1-phenylpropyl)-4-hydroxybenzoic acid
  • 3-[3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.