CAS 1076199-83-1
:2,2′-[[[2-Chloro-9-(1-methylethyl)-9H-purin-6-yl]imino]bis(methylene)]bis[phenol]
Description:
2,2′-[[[2-Chloro-9-(1-methylethyl)-9H-purin-6-yl]imino]bis(methylene)]bis[phenol], identified by its CAS number 1076199-83-1, is a synthetic organic compound that features a complex structure incorporating a purine derivative and bisphenol moieties. This compound exhibits characteristics typical of both purines and phenolic compounds, which may include biological activity, such as potential interactions with nucleic acids or enzymes. The presence of a chlorine atom and an isopropyl group on the purine ring suggests that it may possess unique reactivity and solubility properties. Additionally, the bisphenol structure can contribute to its potential as a ligand or in polymer applications. The compound's molecular structure indicates it may engage in hydrogen bonding and other intermolecular interactions, influencing its physical and chemical properties. Overall, while specific data on its reactivity and applications may vary, the compound's structural features suggest it could be of interest in medicinal chemistry or materials science.
Formula:C22H22ClN5O2
InChI:InChI=1S/C22H22ClN5O2/c1-14(2)28-13-24-19-20(25-22(23)26-21(19)28)27(11-15-7-3-5-9-17(15)29)12-16-8-4-6-10-18(16)30/h3-10,13-14,29-30H,11-12H2,1-2H3
InChI key:InChIKey=VQPSNEQQJJUAQM-UHFFFAOYSA-N
SMILES:N(CC1=C(O)C=CC=C1)(CC2=C(O)C=CC=C2)C3=C4C(N(C(C)C)C=N4)=NC(Cl)=N3
Synonyms:- 2,2′-[[[2-Chloro-9-(1-methylethyl)-9H-purin-6-yl]imino]bis(methylene)]bis[phenol]
- Phenol, 2,2′-[[[2-chloro-9-(1-methylethyl)-9H-purin-6-yl]imino]bis(methylene)]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Chloro-6-[N,N-di(2-hydroxybenzyl)amino]-9-isopropylpurine
CAS:Formula:C22H22ClN5O2Color and Shape:SolidMolecular weight:423.89542-Chloro-6-[N,N-di(2-hydroxybenzyl)amino]-9-isopropylpurine
CAS:Controlled ProductApplications 2-Chloro-6-[N,N-di(2-hydroxybenzyl)amino]-9-isopropylpurine (cas# 1076199-83-1) is a compound useful in organic synthesis.
Formula:C22H22ClN5O2Color and Shape:NeatMolecular weight:423.9

