CAS 1076199-97-7
:N,N-Diethyl-1,6-dihydro-6-oxo-1-phenyl-3-pyridinecarboxamide
Description:
N,N-Diethyl-1,6-dihydro-6-oxo-1-phenyl-3-pyridinecarboxamide is a chemical compound characterized by its complex structure, which includes a pyridine ring and an amide functional group. This substance typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in organic solvents and potential biological activity. The presence of the diethyl group suggests that it may have lipophilic characteristics, which can influence its interaction with biological systems. The compound's oxo and phenyl groups contribute to its reactivity and potential applications in medicinal chemistry. As with many organic compounds, its stability can be affected by environmental factors such as temperature and pH. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in drug development and research. However, detailed studies would be necessary to fully elucidate its behavior, efficacy, and safety profile in various applications.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c1-3-17(4-2)16(20)13-10-11-15(19)18(12-13)14-8-6-5-7-9-14/h5-12H,3-4H2,1-2H3
InChI key:InChIKey=FJJYGDCEVNJNMM-UHFFFAOYSA-N
SMILES:O=C1N(C=C(C(N(CC)CC)=O)C=C1)C2=CC=CC=C2
Synonyms:- N,N-Diethyl-1,6-dihydro-6-oxo-1-phenyl-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, N,N-diethyl-1,6-dihydro-6-oxo-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(N,N-Diethylcarboxamide)-1-phenylpyridin-2(1H)-one
CAS:Controlled ProductApplications 5-(N,N-Diethylcarboxamide)-1-phenylpyridin-2(1H)-one (cas# 1076199-97-7) is a compound useful in organic synthesis.
Formula:C16H18N2O2Color and Shape:NeatMolecular weight:270.33
