CAS 1076200-01-5

Pyrazine, 2,3-diethyl-5-methyl-, 4-oxide

Description:

Pyrazine, 2,3-diethyl-5-methyl-, 4-oxide, identified by its CAS number 1076200-01-5, is a heterocyclic organic compound featuring a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. This compound is characterized by the presence of ethyl groups at the 2 and 3 positions and a methyl group at the 5 position, along with an oxide functional group at the 4 position. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Pyrazines are known for their distinctive, often nutty or roasted aroma, which can contribute to flavor profiles in food and fragrance applications. Additionally, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The stability of the pyrazine ring and the electron-withdrawing nature of the nitrogen atoms can also affect the compound's reactivity in various chemical reactions. Overall, this compound represents a unique structure within the broader class of pyrazines, with potential applications in various fields.

Formula: C₉H₁₄N₂O

InChI: InChI=1S/C9H14N2O/c1-4-8-9(5-2)11(12)7(3)6-10-8/h6H,4-5H2,1-3H3

InChI key: InChIKey=ZRZIYDSIPJMJJT-UHFFFAOYSA-N

SMILES: C(C)C=1C(CC)=NC=C(C)N1=O

Synonyms:

• Pyrazine, 2,3-diethyl-5-methyl-, 4-oxide
• 2,3-Diethyl-5-Methylpyrazine 4-Oxide
• 2,3-DIETHYL-5-METHYLPYRAZINE-N4-OXIDE

2,3-Diethyl-5-methylpyrazine-N4-oxide

Controlled Product

CAS: 1076200-01-5

Applications 2,3-Diethyl-5-methylpyrazine-N4-oxide (cas# 1076200-01-5) is a compound useful in organic synthesis.

Formula: C₉H₁₄N₂O

Color and Shape: Neat

Molecular weight: 166.22

Ref: TR-D444530