CAS 1076200-02-6

2-Ethyl 7,9-dimethyl 4,5-dihydro-5,5-dimethoxy-4-oxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate

Description:

2-Ethyl 7,9-dimethyl 4,5-dihydro-5,5-dimethoxy-4-oxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate is a complex organic compound characterized by its unique pyrroloquinoline structure, which incorporates multiple functional groups, including carboxylate and methoxy moieties. This compound is likely to exhibit significant biological activity due to its intricate molecular architecture, which may influence its interaction with biological targets. The presence of multiple methyl and ethyl substituents suggests potential lipophilicity, which could affect its solubility and permeability in biological systems. Additionally, the tricarboxylate structure may confer acidity, influencing its reactivity and interaction with other chemical species. Given its structural complexity, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, solubility, and spectral characteristics would require empirical data for a comprehensive understanding of its behavior in various environments.

Formula: C₂₀H₂₀N₂O₉

InChI: InChI=1S/C20H20N2O9/c1-6-31-19(26)12-8-10-14(21-12)13-9(17(24)27-2)7-11(18(25)28-3)22-15(13)20(29-4,30-5)16(10)23/h7-8,21H,6H2,1-5H3

InChI key: InChIKey=REQFOHFRVZRQRY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(C(OC)(OC)C(=O)C3=C2NC(C(OCC)=O)=C3)=NC(C(OC)=O)=C1

Synonyms:

• 1H-Pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid, 4,5-dihydro-5,5-dimethoxy-4-oxo-, 2-ethyl 7,9-dimethyl ester
• 2-Ethyl 7,9-dimethyl 4,5-dihydro-5,5-dimethoxy-4-oxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate