CAS 1076200-11-7
:N-[(1,1-Dimethylethoxy)carbonyl]-O-ethyl-3-oxoseryl-β-alanine 1,1-dimethylethyl ester
Description:
N-[(1,1-Dimethylethoxy)carbonyl]-O-ethyl-3-oxoseryl-β-alanine 1,1-dimethylethyl ester is a synthetic organic compound characterized by its complex structure, which includes a β-alanine moiety, an oxo group, and a dimethylethyl ester functional group. This compound is typically used in biochemical research and may serve as an intermediate in the synthesis of more complex molecules. Its structure suggests it possesses both hydrophilic and hydrophobic characteristics, which can influence its solubility and reactivity in various solvents. The presence of the carbonyl and ester functionalities indicates potential for reactivity in nucleophilic addition or esterification reactions. Additionally, the compound may exhibit specific biological activities, making it of interest in pharmaceutical applications. As with many synthetic compounds, safety data and handling precautions should be observed, as the toxicity and environmental impact of this substance are not fully characterized in public databases. Overall, its unique structural features make it a valuable compound for further study in organic and medicinal chemistry.
Formula:C17H30N2O7
InChI:InChI=1S/C17H30N2O7/c1-8-24-14(22)12(19-15(23)26-17(5,6)7)13(21)18-10-9-11(20)25-16(2,3)4/h12H,8-10H2,1-7H3,(H,18,21)(H,19,23)
InChI key:InChIKey=SARYWLRCUHZXGT-UHFFFAOYSA-N
SMILES:C(C(NCCC(OC(C)(C)C)=O)=O)(C(OCC)=O)NC(OC(C)(C)C)=O
Synonyms:- N-[(1,1-Dimethylethoxy)carbonyl]-O-ethyl-3-oxoseryl-β-alanine 1,1-dimethylethyl ester
- β-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-O-ethyl-3-oxoseryl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.