CAS 107624-44-2
:(Biphenyl-2-yloxy)-acetonitrile
Description:
(Biphenyl-2-yloxy)-acetonitrile, with the CAS number 107624-44-2, is an organic compound characterized by its biphenyl structure substituted with an acetonitrile group. This compound typically exhibits properties common to aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the cyano group (-C≡N) contributes to its polarity and potential reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the biphenyl moiety can enhance the compound's lipophilicity, influencing its solubility in organic solvents. This compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Its specific characteristics, such as solubility, reactivity, and stability, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines due to potential toxicity or environmental impact.
Formula:C14H11NO
InChI:InChI=1/C14H11NO/c15-10-11-16-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9H,11H2
SMILES:c1ccc(cc1)c1ccccc1OCC#N
Synonyms:- Acetonitrile, 2-([1,1'-biphenyl]-2-yloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.