CAS 107633-95-4: erycibelline

Description:Erycibelline, with the CAS number 107633-95-4, is a chemical compound that belongs to the class of alkaloids. It is primarily known for its biological activity, particularly in the context of its potential therapeutic applications. Erycibelline exhibits a complex molecular structure, which contributes to its unique pharmacological properties. The compound has been studied for its effects on various biological systems, including its potential role in modulating neurotransmitter activity and influencing cellular signaling pathways. Its solubility characteristics and stability under different conditions are important for its application in research and potential medicinal use. As with many alkaloids, erycibelline may also exhibit toxicity at certain concentrations, necessitating careful handling and dosage considerations in experimental settings. Overall, the study of erycibelline contributes to the broader understanding of natural products and their potential utility in drug development and therapeutic interventions.

Formula:C₇H₁₃NO₂

InChI:InChI=1/C7H13NO2/c9-5-2-1-4-3-6(10)7(5)8-4/h4-10H,1-3H2