CAS 107647-14-3

3-Buten-2-one,4-[(1R,2S,3S,4R,4aS,8aS)-decahydro-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]-,(3E)-

Description:

3-Buten-2-one, 4-[(1R,2S,3S,4R,4aS,8aS)-decahydro-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]-, (3E)-, is a complex organic compound characterized by its unique structural features and stereochemistry. This substance contains a butenone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple hydroxyl groups in the naphthalene derivative indicates that it may exhibit significant hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. The stereochemical configuration, denoted by the specific R and S designations, suggests that the compound may exhibit chiral properties, potentially leading to different biological activities or reactivities depending on its isomeric forms. Additionally, the presence of the naphthalene ring system may impart aromatic characteristics, affecting its stability and electronic properties. Overall, this compound's intricate structure suggests potential utility in various fields, including pharmaceuticals, agrochemicals, and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₈H₃₀O₄

InChI: InChI=1S/C18H30O4/c1-11(19)7-8-12-17(4)10-6-9-16(2,3)14(17)13(20)15(21)18(12,5)22/h7-8,12-15,20-22H,6,9-10H2,1-5H3/b8-7+/t12-,13-,14+,15+,17-,18+/m1/s1

InChI key: InChIKey=GUVJPXABQYFWPD-JOSLJWRDSA-N

SMILES: C[C@]12[C@@]([C@@H](O)[C@H](O)[C@@](C)(O)[C@@H]1/C=C/C(C)=O)(C(C)(C)CCC2)[H]

Synonyms:

• (+)-Sterebin A
• (3E)-4-[(1R,2S,3S,4R,4aS,8aS)-Decahydro-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]-3-buten-2-one
• 3-Buten-2-one,4-(decahydro-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl)-, [1R-[1a(E),2b,3a,4b,4ab,8aa]]-

Sterebins A

CAS: 107647-14-3

Formula: C₁₈H₃₀O₄

Purity: 95%~99%

Molecular weight: 310.434

Ref: BP-BP4903

Sterebin A

CAS: 107647-14-3

Sterebin A may have anti-inflammatory activity.

Formula: C₁₈H₃₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 310.43

Ref: TM-TN2236

Sterebin A - Stevia rebaudiana

CAS: 107647-14-3

Sterebin A is a natural sweetener, which is derived from the plant Stevia rebaudiana, a species native to South America. The primary source of Sterebin A is the leaves of this plant, which contain glycosides such as stevioside and rebaudioside. These glycosides interact with taste receptors on the tongue, providing a sweetness that is significantly more intense than sucrose, without the caloric content. The biochemical mechanism involves the binding of these compounds to specific receptor sites, simulating the perception of sweetness in humans.

Formula: C₁₈H₃₀O₄

Purity: 90%Min

Color and Shape: Powder

Molecular weight: 310.43 g/mol

Ref: 3D-XS170488

Sterebin A

Controlled Product

CAS: 107647-14-3

Applications Sterebin A - (CAS# 107647-14-3) is a useful research chemical compound.

Formula: C₁₈H₃₀O₄

Color and Shape: Neat

Molecular weight: 310.43

Ref: TR-S213270