CAS 107648-78-2

Cefepime sulfate

Description:

Cefepime sulfate is a broad-spectrum cephalosporin antibiotic, classified as a fourth-generation cephalosporin. It is primarily used to treat a variety of bacterial infections, particularly those caused by Gram-negative bacteria, including Pseudomonas aeruginosa. Cefepime exhibits a high degree of stability against beta-lactamases, which are enzymes produced by some bacteria that can inactivate other antibiotics. The compound is typically administered intravenously or intramuscularly, allowing for rapid absorption and distribution in the body. Its mechanism of action involves inhibiting bacterial cell wall synthesis, leading to cell lysis and death. Cefepime is generally well-tolerated, but potential side effects may include allergic reactions, gastrointestinal disturbances, and alterations in blood cell counts. The sulfate form enhances its solubility and stability in solution, making it suitable for clinical use. As with any antibiotic, appropriate susceptibility testing is recommended to ensure effectiveness against specific pathogens.

Formula: C₁₉H₂₆N₆O₉S₃

InChI: InChI=1/C19H24N6O5S2.H2O4S/c1-25(5-3-4-6-25)7-10-8-31-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(23-30-2)11-9-32-19(20)21-11;1-5(2,3)4/h9,13,17H,3-8H2,1-2H3,(H3-,20,21,22,26,28,29);(H2,1,2,3,4)/b23-12-;/t13-,17-;/m1./s1

SMILES: C[N+]1(CCCC1)CC1=C(C(=O)[O-])N2C(=O)[C@H]([C@H]2SC1)N=C(/C(=N\OC)/c1csc(=N)[nH]1)O.OS(=O)(=O)O

Synonyms:

• (6R,7R)-7-[[(2E)-2-(2-Amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid sulfate

Cefepime-d3 Sulfate

Controlled Product

CAS: 107648-78-2

Formula: C₁₉H₂₃D₃N₆O₉S₃

Color and Shape: Beige To Light Brown

Molecular weight: 581.66

Ref: TR-C242756

Cefepime-D3,13C Sulfate

Controlled Product

CAS: 107648-78-2, 88376-58-3

Formula: CC₁₈D₃H₂₂N₆O₅S₂·H₂SO₄

Color and Shape: Neat

Molecular weight: 583.659

Ref: TR-C242758