CAS 107671-54-5
:methyl (2R)-2-[(2S,3S,4R,5S)-3-acetamido-2-benzyloxy-6-(benzyloxymethyl)-5-hydroxy-tetrahydropyran-4-yl]oxypropanoate
Description:
Methyl (2R)-2-[(2S,3S,4R,5S)-3-acetamido-2-benzyloxy-6-(benzyloxymethyl)-5-hydroxy-tetrahydropyran-4-yl]oxypropanoate, with CAS number 107671-54-5, is a complex organic compound characterized by its intricate stereochemistry and functional groups. This molecule features a tetrahydropyran ring, which contributes to its cyclic structure, and includes multiple substituents such as an acetamido group and benzyloxy groups, enhancing its reactivity and potential biological activity. The presence of the methyl ester functional group indicates that it can undergo hydrolysis, making it relevant in various chemical reactions. Its stereochemical configuration suggests that it may exhibit specific interactions in biological systems, potentially influencing its pharmacological properties. The compound's solubility and stability can vary based on the solvent and environmental conditions, which are critical for its application in research or pharmaceutical contexts. Overall, this compound exemplifies the complexity often found in organic chemistry, particularly in the design of molecules for therapeutic purposes.
Formula:C26H33NO8
InChI:InChI=1/C26H33NO8/c1-17(25(30)31-3)34-24-22(27-18(2)28)26(33-15-20-12-8-5-9-13-20)35-21(23(24)29)16-32-14-19-10-6-4-7-11-19/h4-13,17,21-24,26,29H,14-16H2,1-3H3,(H,27,28)/t17-,21?,22+,23-,24-,26+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzyl N-acetyl-6-O-benzyl-a-D-muramic acid methyl ester
CAS:Benzyl N-acetyl-6-O-benzyl-a-D-muramic acid methyl ester is a synthetic glycosylation that is custom synthesized for the purpose of modifying glycoproteins. This compound can be used to add a fluorinated sugar to the glycan chain, which can help increase the drug's bioavailability. The synthesis of this compound is achieved through a click modification reaction.Formula:C26H33NO8Purity:Min. 95%Molecular weight:487.54 g/mol

