CAS 107694-27-9
:octyl(phenyl)phosphane oxide
Description:
Octyl(phenyl)phosphane oxide, with the CAS number 107694-27-9, is an organophosphorus compound characterized by the presence of both octyl and phenyl groups attached to a phosphorus atom, which is also bonded to an oxygen atom, forming a phosphane oxide. This compound typically exhibits properties such as being a colorless to pale yellow liquid with a distinctive odor. It is known for its role as a ligand in coordination chemistry and as a potential additive in various chemical processes. The presence of the octyl group contributes to its hydrophobic characteristics, while the phenyl group can enhance its stability and reactivity. Octyl(phenyl)phosphane oxide is soluble in organic solvents but has limited solubility in water, making it useful in applications where organic phase interactions are critical. Additionally, it may exhibit biological activity, which warrants careful handling and consideration of safety protocols during use. Overall, its unique structure and properties make it valuable in both industrial and research settings.
Formula:C14H23OP
InChI:InChI=1/C14H23OP/c1-2-3-4-5-6-10-13-16(15)14-11-8-7-9-12-14/h7-9,11-12,16H,2-6,10,13H2,1H3
Synonyms:- phosphorane, octylphenyl-, oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
