CAS 1077-04-9

2-amino-6-[(2-hydroxyethyl)amino]pyrimidin-4(1H)-one

Description:

2-amino-6-[(2-hydroxyethyl)amino]pyrimidin-4(1H)-one, with the CAS number 1077-04-9, is a pyrimidine derivative characterized by the presence of an amino group and a hydroxyethylamino substituent. This compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The amino group at position 2 and the hydroxyethylamino group at position 6 contribute to its polar nature, enhancing its solubility in water. The presence of the hydroxyl group also suggests potential for hydrogen bonding, which can influence its reactivity and interactions with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. Its structural characteristics suggest it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, which are common in organic synthesis. Overall, 2-amino-6-[(2-hydroxyethyl)amino]pyrimidin-4(1H)-one is a versatile compound with potential applications in medicinal chemistry.

Formula: C₆H₁₀N₄O₂

InChI: InChI=1/C6H10N4O2/c7-6-9-4(8-1-2-11)3-5(12)10-6/h3,11H,1-2H2,(H4,7,8,9,10,12)

SMILES: C(CO)Nc1cc(nc(=N)[nH]1)O