CAS 1077-58-3
:2-tert-Butylbenzoic acid
Description:
2-tert-Butylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a tert-butyl group attached to the benzene ring at the second position relative to the carboxylic acid functional group. This compound typically appears as a white to off-white crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. The presence of the bulky tert-butyl group influences its physical and chemical properties, such as melting point and boiling point, making it less reactive than simpler benzoic acids. It exhibits typical acid behavior, capable of donating a proton in solution, and can participate in various chemical reactions, including esterification and acylation. Additionally, 2-tert-Butylbenzoic acid may be utilized in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation to skin and eyes.
Formula:C11H14O2
InChI:InChI=1/C11H14O2/c1-11(2,3)9-7-5-4-6-8(9)10(12)13/h4-7H,1-3H3,(H,12,13)
SMILES:CC(C)(C)c1ccccc1C(=O)O
Synonyms:- 215-299-5
- Benzoic Acid, 2-(1,1-Dimethylethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-tert-Butylbenzoic acid
CAS:Formula:C11H14O2Purity:98%Color and Shape:SolidMolecular weight:178.22772-(tert-Butyl)benzoic acid
CAS:2-(tert-Butyl)benzoic acid
Formula:C11H14O2Purity:98%Color and Shape: white solidMolecular weight:178.23g/mol2-tert-Butylbenzoic Acid
CAS:Controlled ProductApplications 2-tert-Butylbenzoic Acid is a useful research chemical for organic synthesis and other chemical processes.
References Kulhanek, J., et al.: Eur. J. Org. Chem, 7, 1589 (1999); Yamada, K., et al.: Bioorg. Med. Chem., 17, 5928 (2009); Berger, S.: Tetrahedron, 32. 2451 (1976)Formula:C11H14O2Color and Shape:NeatMolecular weight:178.23



