CAS 107738-50-1
:1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methyl-4-[(trifluoromethyl)sulfanyl]-1H-pyrazole
Description:
1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-3-methyl-4-[(trifluoromethyl)sulfanyl]-1H-pyrazole, with CAS number 107738-50-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrazole ring substituted with various functional groups. The presence of dichloro and trifluoromethyl groups indicates significant electronegativity and potential for strong intermolecular interactions, which can influence its reactivity and solubility. This compound is likely to exhibit notable biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its trifluoromethyl and sulfanyl substituents may enhance lipophilicity and metabolic stability. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other substances. Overall, the unique combination of halogenated and sulfur-containing groups suggests that this compound could play a role in various chemical applications, including as a potential lead compound in drug discovery or as an agrochemical.
Formula:C12H6Cl2F6N2S
InChI:InChI=1/C12H6Cl2F6N2S/c1-5-9(23-12(18,19)20)4-22(21-5)10-7(13)2-6(3-8(10)14)11(15,16)17/h2-4H,1H3
SMILES:Cc1c(cn(c2c(cc(cc2Cl)C(F)(F)F)Cl)n1)SC(F)(F)F
Synonyms:- 1H-Pyrazole, 1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-3-methyl-4-((trifluoromethyl)thio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
JKU 0422
CAS:JKU 0422 is a bioactive chemical.Formula:C12H6Cl2F6N2SColor and Shape:SolidMolecular weight:395.15
