CAS 107754-20-1

4-[[5-[[cyclopentyloxy)carbonyl]amino]-1-methylindol-3-yl]methyl]-3-methoxybenzoic acid

Description:

4-[[5-[[cyclopentyloxy)carbonyl]amino]-1-methylindol-3-yl]methyl]-3-methoxybenzoic acid, with the CAS number 107754-20-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an indole moiety, a methoxy group, and a cyclopentyloxycarbonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of functional groups like carboxylic acid and amine suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Its structure indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the compound's stability, melting point, and specific reactivity would depend on the surrounding conditions and the presence of other reactants. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.

Formula: C₂₄H₂₆N₂O₅

InChI: InChI=1/C24H26N2O5/c1-26-14-17(11-15-7-8-16(23(27)28)12-22(15)30-2)20-13-18(9-10-21(20)26)25-24(29)31-19-5-3-4-6-19/h7-10,12-14,19H,3-6,11H2,1-2H3,(H,25,29)(H,27,28)

SMILES: Cn1cc(Cc2ccc(cc2OC)C(=O)O)c2cc(ccc12)N=C(O)OC1CCCC1

Synonyms:

• 4-(5-Cyclopentyloxycarbonylamino-1-Methylindol-3-Ylmethoxybenzoic Acid)
• 4-[(5-{[(cyclopentyloxy)carbonyl]amino}-1-methyl-1H-indol-3-yl)methyl]-3-methoxybenzoic acid

Zafirlukast Impurity 6

CAS: 107754-20-1

Formula: C₂₄H₂₆N₂O₅

Molecular weight: 422.48

Ref: 4Z-Z-1213

4-[[5-[[(Cyclopentyloxy)carbonyl]amino]-1-methyl-1H-indol-3-yl]methyl]-3-methoxybenzoic Acid

Controlled Product

CAS: 107754-20-1

Applications An intermediate of Zafirlukast (Z125000), as leukotriene antagonist.
References Samuelsson, B., et al.: Science, 220, 568 (1983), Matassa, V.G., et al.: J. Med. Chem., 33, 1781 (1990), Wenzel, S., et al.: Pharmacotherapy, 17, 3S (1997),

Formula: C₂₄H₂₆N₂O₅

Color and Shape: Neat

Molecular weight: 422.47

Ref: TR-C988550

Zafirlukast Impurity 5

CAS: 107754-20-1

Formula: C₂₄H₂₆N₂O₅

Molecular weight: 422.48

Ref: ST-EA-CP-Z7005