
CAS 107767-55-5
:3,9-Dihydro-1-(5-hydroxy-5-methylhexyl)-3-methyl-1H-purine-2,6-dione
Description:
3,9-Dihydro-1-(5-hydroxy-5-methylhexyl)-3-methyl-1H-purine-2,6-dione, commonly known by its CAS number 107767-55-5, is a purine derivative characterized by its complex molecular structure, which includes a purine ring system and various functional groups. This compound features a hydroxyl group and a branched alkyl chain, contributing to its solubility and potential biological activity. It is known for its role as a metabolite in biological systems and may exhibit pharmacological properties, particularly in relation to its interactions with adenosine receptors. The presence of the hydroxyl and methyl groups can influence its reactivity and stability, making it of interest in medicinal chemistry. Additionally, its structural features suggest potential applications in drug development, particularly in areas targeting neurological or cardiovascular conditions. As with many purine derivatives, it may also play a role in cellular signaling pathways. However, specific biological activities and therapeutic potentials would require further investigation through experimental studies.
Formula:C13H20N4O3
InChI:InChI=1S/C13H20N4O3/c1-13(2,20)6-4-5-7-17-11(18)9-10(15-8-14-9)16(3)12(17)19/h8,20H,4-7H2,1-3H3,(H,14,15)
InChI key:InChIKey=NWXULHNEYYFVMF-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(C)C(=O)N1CCCCC(C)(C)O)N=CN2
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-1-(5-hydroxy-5-methylhexyl)-3-methyl-
- 3,9-Dihydro-1-(5-hydroxy-5-methylhexyl)-3-methyl-1H-purine-2,6-dione
- A 81-3138
- 1H-Purine-2,6-dione, 3,9-dihydro-1-(5-hydroxy-5-methylhexyl)-3-methyl-
- HWA 138
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Albifylline
CAS:Albifylline: a xanthine derivative, anti-asthmatic, reduces leukocyte adhesion, enhances liver microcirculation post-hemorrhagic shock.Formula:C13H20N4O3Color and Shape:SolidMolecular weight:280.32
