CAS 107767-58-8
:1-(5-hydroxy-5-methylhexyl)-3-methyl-7-propyl-3,7-dihydro-1H-purine-2,6-dione
Description:
The chemical substance known as 1-(5-hydroxy-5-methylhexyl)-3-methyl-7-propyl-3,7-dihydro-1H-purine-2,6-dione, with the CAS number 107767-58-8, is a purine derivative that exhibits characteristics typical of compounds in this class. It is likely to possess a complex structure featuring multiple functional groups, including hydroxyl and alkyl chains, which can influence its solubility, stability, and biological activity. This compound may exhibit pharmacological properties, potentially acting as a modulator of biological pathways due to its purine core, which is integral to various biochemical processes, including energy transfer and signal transduction. The presence of the hydroxy and alkyl substituents suggests that it may interact with biological receptors or enzymes, making it of interest in medicinal chemistry. Additionally, its molecular weight and specific stereochemistry could affect its pharmacokinetics and pharmacodynamics. Overall, this compound represents a unique structure within the purine family, with potential applications in therapeutic contexts, although specific biological activities would require further investigation.
Formula:C16H26N4O3
InChI:InChI=1/C16H26N4O3/c1-5-9-19-11-17-13-12(19)14(21)20(15(22)18(13)4)10-7-6-8-16(2,3)23/h11,23H,5-10H2,1-4H3
SMILES:CCCn1cnc2c1c(=O)n(CCCCC(C)(C)O)c(=O)n2C
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-1-(5-hydroxy-5-methylhexyl)-3-methyl-7-propyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
A-802715
CAS:Controlled ProductA-802715 is a methylxanthine derivative with inhibitory effects on cyclase. It has been shown to inhibit the production of tumour necrosis factor-α (TNF-α) and cytokines in vitro and in vivo. A-802715 has also been shown to have cytotoxic effects on tumour cells, as well as inhibit the production of nitric oxide and other inflammatory mediators. The drug was effective against tumours induced by phytohaemagglutinin or necrosis factor, but not against those induced by ischemia reperfusion or theophylline. Additionally, A-802715 inhibits the incorporation of radioactive caffeine into DNA in vitro at concentrations of 10 μM.
Formula:C16H26N4O3Purity:Min. 95%Molecular weight:322.4 g/molA-802715
CAS:A-802715 is a novel methylxanthine derivative that decreases the endogenous formation and blood levels of pro-inflammatory substances and increases theFormula:C16H26N4O3Purity:96.29%Color and Shape:SolidMolecular weight:322.4


