CAS 107774-17-4
:ethyl 4-(5-chloro-2-methoxy-phenyl)-4-oxo-butanoate
Description:
Ethyl 4-(5-chloro-2-methoxy-phenyl)-4-oxo-butanoate, identified by its CAS number 107774-17-4, is an organic compound characterized by its ester functional group and a substituted aromatic ring. This compound features a butanoate backbone, which contributes to its reactivity and solubility properties. The presence of a chloro group and a methoxy group on the aromatic ring enhances its potential for various chemical reactions, including electrophilic aromatic substitution. The compound is likely to exhibit moderate polarity due to the ester and methoxy functionalities, influencing its solubility in organic solvents and water. Additionally, the presence of the chloro substituent may impart unique biological activities, making it of interest in pharmaceutical research. Its structural characteristics suggest potential applications in organic synthesis and medicinal chemistry, although specific biological or pharmacological properties would require further investigation. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H15ClO4
InChI:InChI=1/C13H15ClO4/c1-3-18-13(16)7-5-11(15)10-8-9(14)4-6-12(10)17-2/h4,6,8H,3,5,7H2,1-2H3
SMILES:CCOC(=O)CCC(=O)c1cc(ccc1OC)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.