CAS 1078-61-1: Dihydrocaffeic acid
Description:Dihydrocaffeic acid, with the CAS number 1078-61-1, is a phenolic compound that is structurally related to caffeic acid. It is characterized by its two hydroxyl groups and a double bond in the aromatic ring, which contribute to its antioxidant properties. This compound is typically found in various plant sources and is known for its potential health benefits, including anti-inflammatory and neuroprotective effects. Dihydrocaffeic acid is soluble in polar solvents, which facilitates its extraction from plant materials. Its chemical structure allows it to participate in various biochemical reactions, making it of interest in both nutritional and pharmaceutical research. Additionally, it may play a role in the metabolism of other phenolic compounds and contribute to the overall health benefits associated with diets rich in fruits and vegetables. As research continues, the full range of its biological activities and potential applications in health and medicine are being explored.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13)
InChI key:InChIKey=DZAUWHJDUNRCTF-UHFFFAOYSA-N
SMILES:O=C(O)CCC1=CC=C(O)C(O)=C1
- Synonyms:
- 3,4-Dihydroxy-β-phenylpropionic acid
- 3,4-Dihydroxybenzenepropanoic acid
- 3,4-Dihydroxybenzenepropionic acid
- 3,4-Dihydroxydihydrocinnamic acid
- 3,4-Dihydroxyhydrocinnamic acid
- 3-(3,4-Dihydroxyphenyl)Propanoate
- 3-(3,4-Dihydroxyphenyl)Propanoic Acid
- 3-(3,4-Dihydroxyphenyl)propionic acid
- Benzenepropanoic acid, 3,4-dihydroxy-
- Dihydrocaffeic acid
- See more synonyms
- Hydrocaffeic acid
- Hydrocinnamic acid, 3,4-dihydroxy-
- NSC 407275
- NSC 624007
- Stbb 8922V
